C17H22N4O3S — CID 27869210
1-[[2-[(dimethylamino)methyl]phenyl]methyl]-3-(4-sulfamoylphenyl)urea (PubChem CID 27869210) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is 1-[[2-[(dimethylamino)methyl]phenyl]methyl]-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-[[2-[(dimethylamino)methyl]phenyl]methyl]-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 27869210 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 1-[[2-[(dimethylamino)methyl]phenyl]methyl]-3-(4-sulfamoylphenyl)urea |
| SMILES | CN(C)Cc1ccccc1CNC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H22N4O3S/c1-21(2)12-14-6-4-3-5-13(14)11-19-17(22)20-15-7-9-16(10-8-15)25(18,23)24/h3-10H,11-12H2,1-2H3,(H2,18,23,24)(H2,19,20,22) |
| InChIKey | GSHNWFBFGUXCGK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |