C20H27N3O4S — CID 47081340
1-[4-[butyl(methyl)sulfamoyl]phenyl]-3-[[2-(hydroxymethyl)phenyl]methyl]urea (PubChem CID 47081340) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is 1-[4-[butyl(methyl)sulfamoyl]phenyl]-3-[[2-(hydroxymethyl)phenyl]methyl]urea.
| Compound Name | 1-[4-[butyl(methyl)sulfamoyl]phenyl]-3-[[2-(hydroxymethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 47081340 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1-[4-[butyl(methyl)sulfamoyl]phenyl]-3-[[2-(hydroxymethyl)phenyl]methyl]urea |
| SMILES | CCCCN(C)S(=O)(=O)c1ccc(NC(=O)NCc2ccccc2CO)cc1 |
| InChI | InChI=1S/C20H27N3O4S/c1-3-4-13-23(2)28(26,27)19-11-9-18(10-12-19)22-20(25)21-14-16-7-5-6-8-17(16)15-24/h5-12,24H,3-4,13-15H2,1-2H3,(H2,21,22,25) |
| InChIKey | ZNZUAGIPGVYBDF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |