C11H18N8O — CID 106280898
3-[(6-hydrazinyl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)amino]-N,2,2-trimethylpropanamide (PubChem CID 106280898) has the molecular formula C11H18N8O and a molecular weight of 278.32 g/mol. Its IUPAC name is 3-[(6-hydrazinyl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)amino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(6-hydrazinyl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)amino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106280898 |
| Molecular Formula | C11H18N8O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 3-[(6-hydrazinyl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)amino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNc1nc(NN)nc2[nH]ncc12 |
| InChI | InChI=1S/C11H18N8O/c1-11(2,9(20)13-3)5-14-7-6-4-15-19-8(6)17-10(16-7)18-12/h4H,5,12H2,1-3H3,(H,13,20)(H3,14,15,16,17,18,19) |
| InChIKey | QNOFWOJUKRSRHB-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 133.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|