C11H14F4N6 — CID 106296188
6-N-propyl-4-N-(2,2,3,3-tetrafluoropropyl)-1H-pyrazolo[5,4-d]pyrimidine-4,6-diamine (PubChem CID 106296188) has the molecular formula C11H14F4N6 and a molecular weight of 306.27 g/mol. Its IUPAC name is 6-N-propyl-4-N-(2,2,3,3-tetrafluoropropyl)-1H-pyrazolo[5,4-d]pyrimidine-4,6-diamine.
| Compound Name | 6-N-propyl-4-N-(2,2,3,3-tetrafluoropropyl)-1H-pyrazolo[5,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106296188 |
| Molecular Formula | C11H14F4N6 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 6-N-propyl-4-N-(2,2,3,3-tetrafluoropropyl)-1H-pyrazolo[5,4-d]pyrimidine-4,6-diamine |
| SMILES | CCCNc1nc(NCC(F)(F)C(F)F)c2cn[nH]c2n1 |
| InChI | InChI=1S/C11H14F4N6/c1-2-3-16-10-19-7(6-4-18-21-8(6)20-10)17-5-11(14,15)9(12)13/h4,9H,2-3,5H2,1H3,(H3,16,17,18,19,20,21) |
| InChIKey | RHCXLVBKLJCFJM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|