C12H18F4N4 — CID 106296144
5-ethyl-6-N-propyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-4,6-diamine (PubChem CID 106296144) has the molecular formula C12H18F4N4 and a molecular weight of 294.30 g/mol. Its IUPAC name is 5-ethyl-6-N-propyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-4,6-diamine.
| Compound Name | 5-ethyl-6-N-propyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106296144 |
| Molecular Formula | C12H18F4N4 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 5-ethyl-6-N-propyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-4,6-diamine |
| SMILES | CCCNc1ncnc(NCC(F)(F)C(F)F)c1CC |
| InChI | InChI=1S/C12H18F4N4/c1-3-5-17-9-8(4-2)10(20-7-19-9)18-6-12(15,16)11(13)14/h7,11H,3-6H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | MPZNXMFYAZGISC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|