C13H20F4N4 — CID 106296233
6-N,2-dipropyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-4,6-diamine (PubChem CID 106296233) has the molecular formula C13H20F4N4 and a molecular weight of 308.32 g/mol. Its IUPAC name is 6-N,2-dipropyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N,2-dipropyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106296233 |
| Molecular Formula | C13H20F4N4 |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 6-N,2-dipropyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-4,6-diamine |
| SMILES | CCCNc1cc(NCC(F)(F)C(F)F)nc(CCC)n1 |
| InChI | InChI=1S/C13H20F4N4/c1-3-5-9-20-10(18-6-4-2)7-11(21-9)19-8-13(16,17)12(14)15/h7,12H,3-6,8H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | BNLUUHZCRVSKPP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|