C9H9F7N4 — CID 106296239
6-N-methyl-4-N-(2,2,3,3-tetrafluoropropyl)-2-(trifluoromethyl)pyrimidine-4,6-diamine (PubChem CID 106296239) has the molecular formula C9H9F7N4 and a molecular weight of 306.19 g/mol. Its IUPAC name is 6-N-methyl-4-N-(2,2,3,3-tetrafluoropropyl)-2-(trifluoromethyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-methyl-4-N-(2,2,3,3-tetrafluoropropyl)-2-(trifluoromethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106296239 |
| Molecular Formula | C9H9F7N4 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 6-N-methyl-4-N-(2,2,3,3-tetrafluoropropyl)-2-(trifluoromethyl)pyrimidine-4,6-diamine |
| SMILES | CNc1cc(NCC(F)(F)C(F)F)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H9F7N4/c1-17-4-2-5(18-3-8(12,13)6(10)11)20-7(19-4)9(14,15)16/h2,6H,3H2,1H3,(H2,17,18,19,20) |
| InChIKey | CTVBICWXWFGBLU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|