C8H8F7N5 — CID 106294493
6-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106294493) has the molecular formula C8H8F7N5 and a molecular weight of 307.17 g/mol. Its IUPAC name is 6-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106294493 |
| Molecular Formula | C8H8F7N5 |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 6-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | NNc1cc(NCC(F)(F)C(F)F)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H8F7N5/c9-5(10)7(11,12)2-17-3-1-4(20-16)19-6(18-3)8(13,14)15/h1,5H,2,16H2,(H2,17,18,19,20) |
| InChIKey | FERKWHBGTCTYIF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|