C7H10F4N6 — CID 106294412
6-hydrazinyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-2,4-diamine (PubChem CID 106294412) has the molecular formula C7H10F4N6 and a molecular weight of 254.19 g/mol. Its IUPAC name is 6-hydrazinyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-2,4-diamine.
| Compound Name | 6-hydrazinyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 106294412 |
| Molecular Formula | C7H10F4N6 |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 6-hydrazinyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-2,4-diamine |
| SMILES | NNc1cc(NCC(F)(F)C(F)F)nc(N)n1 |
| InChI | InChI=1S/C7H10F4N6/c8-5(9)7(10,11)2-14-3-1-4(17-13)16-6(12)15-3/h1,5H,2,13H2,(H4,12,14,15,16,17) |
| InChIKey | ZWWBYSRLLUSGRA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|