C10H21N7 — CID 80900880
4-N-[2-(dimethylamino)-2-methylpropyl]-6-hydrazinylpyrimidine-2,4-diamine (PubChem CID 80900880) has the molecular formula C10H21N7 and a molecular weight of 239.33 g/mol. Its IUPAC name is 4-N-[2-(dimethylamino)-2-methylpropyl]-6-hydrazinylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[2-(dimethylamino)-2-methylpropyl]-6-hydrazinylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80900880 |
| Molecular Formula | C10H21N7 |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 4-N-[2-(dimethylamino)-2-methylpropyl]-6-hydrazinylpyrimidine-2,4-diamine |
| SMILES | CN(C)C(C)(C)CNc1cc(NN)nc(N)n1 |
| InChI | InChI=1S/C10H21N7/c1-10(2,17(3)4)6-13-7-5-8(16-12)15-9(11)14-7/h5H,6,12H2,1-4H3,(H4,11,13,14,15,16) |
| InChIKey | HJRJIDBYBLPJQC-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|