C6H13N7 — CID 83027397
4-(2,2-dimethylhydrazinyl)-6-hydrazinylpyrimidin-2-amine (PubChem CID 83027397) has the molecular formula C6H13N7 and a molecular weight of 183.22 g/mol. Its IUPAC name is 4-(2,2-dimethylhydrazinyl)-6-hydrazinylpyrimidin-2-amine.
| Compound Name | 4-(2,2-dimethylhydrazinyl)-6-hydrazinylpyrimidin-2-amine |
|---|---|
| PubChem CID | 83027397 |
| Molecular Formula | C6H13N7 |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | 4-(2,2-dimethylhydrazinyl)-6-hydrazinylpyrimidin-2-amine |
| SMILES | CN(C)Nc1cc(NN)nc(N)n1 |
| InChI | InChI=1S/C6H13N7/c1-13(2)12-5-3-4(11-8)9-6(7)10-5/h3H,8H2,1-2H3,(H4,7,9,10,11,12) |
| InChIKey | GJRJXXVMKUGPIK-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|