C8H17N7 — CID 80932754
4-N-[2-(dimethylamino)ethyl]-6-hydrazinylpyrimidine-2,4-diamine (PubChem CID 80932754) has the molecular formula C8H17N7 and a molecular weight of 211.27 g/mol. Its IUPAC name is 4-N-[2-(dimethylamino)ethyl]-6-hydrazinylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[2-(dimethylamino)ethyl]-6-hydrazinylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80932754 |
| Molecular Formula | C8H17N7 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.15 |
| IUPAC Name | 4-N-[2-(dimethylamino)ethyl]-6-hydrazinylpyrimidine-2,4-diamine |
| SMILES | CN(C)CCNc1cc(NN)nc(N)n1 |
| InChI | InChI=1S/C8H17N7/c1-15(2)4-3-11-6-5-7(14-10)13-8(9)12-6/h5H,3-4,10H2,1-2H3,(H4,9,11,12,13,14) |
| InChIKey | AFPUQMKMEKQOSG-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|