C10H20N6O — CID 82946500
6-hydrazinyl-4-N-(3-propoxypropyl)pyrimidine-2,4-diamine (PubChem CID 82946500) has the molecular formula C10H20N6O and a molecular weight of 240.31 g/mol. Its IUPAC name is 6-hydrazinyl-4-N-(3-propoxypropyl)pyrimidine-2,4-diamine.
| Compound Name | 6-hydrazinyl-4-N-(3-propoxypropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 82946500 |
| Molecular Formula | C10H20N6O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 6-hydrazinyl-4-N-(3-propoxypropyl)pyrimidine-2,4-diamine |
| SMILES | CCCOCCCNc1cc(NN)nc(N)n1 |
| InChI | InChI=1S/C10H20N6O/c1-2-5-17-6-3-4-13-8-7-9(16-12)15-10(11)14-8/h7H,2-6,12H2,1H3,(H4,11,13,14,15,16) |
| InChIKey | BFTJOJPQUPLIKH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|