C11H22N6O — CID 80903582
6-hydrazinyl-4-N-[2-(3-methylbutoxy)ethyl]pyrimidine-2,4-diamine (PubChem CID 80903582) has the molecular formula C11H22N6O and a molecular weight of 254.34 g/mol. Its IUPAC name is 6-hydrazinyl-4-N-[2-(3-methylbutoxy)ethyl]pyrimidine-2,4-diamine.
| Compound Name | 6-hydrazinyl-4-N-[2-(3-methylbutoxy)ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80903582 |
| Molecular Formula | C11H22N6O |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 6-hydrazinyl-4-N-[2-(3-methylbutoxy)ethyl]pyrimidine-2,4-diamine |
| SMILES | CC(C)CCOCCNc1cc(NN)nc(N)n1 |
| InChI | InChI=1S/C11H22N6O/c1-8(2)3-5-18-6-4-14-9-7-10(17-13)16-11(12)15-9/h7-8H,3-6,13H2,1-2H3,(H4,12,14,15,16,17) |
| InChIKey | PASAYRWEVJCSPH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|