C14H25N3O — CID 80820194
2-N-ethyl-6-N-[2-(3-methylbutoxy)ethyl]pyridine-2,6-diamine (PubChem CID 80820194) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-N-ethyl-6-N-[2-(3-methylbutoxy)ethyl]pyridine-2,6-diamine.
| Compound Name | 2-N-ethyl-6-N-[2-(3-methylbutoxy)ethyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80820194 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 2-N-ethyl-6-N-[2-(3-methylbutoxy)ethyl]pyridine-2,6-diamine |
| SMILES | CCNc1cccc(NCCOCCC(C)C)n1 |
| InChI | InChI=1S/C14H25N3O/c1-4-15-13-6-5-7-14(17-13)16-9-11-18-10-8-12(2)3/h5-7,12H,4,8-11H2,1-3H3,(H2,15,16,17) |
| InChIKey | HWNHQPYLWRAQDD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|