C12H21N5O2 — CID 122058445
4-[[2-amino-6-(butylamino)pyrimidin-4-yl]amino]butanoic acid (PubChem CID 122058445) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-[[2-amino-6-(butylamino)pyrimidin-4-yl]amino]butanoic acid.
| Compound Name | 4-[[2-amino-6-(butylamino)pyrimidin-4-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 122058445 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 4-[[2-amino-6-(butylamino)pyrimidin-4-yl]amino]butanoic acid |
| SMILES | CCCCNc1cc(NCCCC(=O)O)nc(N)n1 |
| InChI | InChI=1S/C12H21N5O2/c1-2-3-6-14-9-8-10(17-12(13)16-9)15-7-4-5-11(18)19/h8H,2-7H2,1H3,(H,18,19)(H4,13,14,15,16,17) |
| InChIKey | IFPFSGHFAPHEFO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|