C8H13FN4 — CID 2780461
4-N-butyl-6-fluoropyrimidine-2,4-diamine (PubChem CID 2780461) has the molecular formula C8H13FN4 and a molecular weight of 184.22 g/mol. Its IUPAC name is 4-N-butyl-6-fluoropyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-6-fluoropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 2780461 |
| Molecular Formula | C8H13FN4 |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 4-N-butyl-6-fluoropyrimidine-2,4-diamine |
| SMILES | CCCCNc1cc(F)nc(N)n1 |
| InChI | InChI=1S/C8H13FN4/c1-2-3-4-11-7-5-6(9)12-8(10)13-7/h5H,2-4H2,1H3,(H3,10,11,12,13) |
| InChIKey | MLSJTJJSMGOSAW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|