C14H25N5O2 — CID 122126419
4-[[2-amino-6-(butylamino)pyrimidin-4-yl]amino]-2,2-dimethylbutanoic acid (PubChem CID 122126419) has the molecular formula C14H25N5O2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 4-[[2-amino-6-(butylamino)pyrimidin-4-yl]amino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[[2-amino-6-(butylamino)pyrimidin-4-yl]amino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122126419 |
| Molecular Formula | C14H25N5O2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 4-[[2-amino-6-(butylamino)pyrimidin-4-yl]amino]-2,2-dimethylbutanoic acid |
| SMILES | CCCCNc1cc(NCCC(C)(C)C(=O)O)nc(N)n1 |
| InChI | InChI=1S/C14H25N5O2/c1-4-5-7-16-10-9-11(19-13(15)18-10)17-8-6-14(2,3)12(20)21/h9H,4-8H2,1-3H3,(H,20,21)(H4,15,16,17,18,19) |
| InChIKey | KCYJGUKJHCQSOM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|