C9H17N5 — CID 80784820
4-N-butyl-6-N-methylpyrimidine-2,4,6-triamine (PubChem CID 80784820) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is 4-N-butyl-6-N-methylpyrimidine-2,4,6-triamine.
| Compound Name | 4-N-butyl-6-N-methylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80784820 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 4-N-butyl-6-N-methylpyrimidine-2,4,6-triamine |
| SMILES | CCCCNc1cc(NC)nc(N)n1 |
| InChI | InChI=1S/C9H17N5/c1-3-4-5-12-8-6-7(11-2)13-9(10)14-8/h6H,3-5H2,1-2H3,(H4,10,11,12,13,14) |
| InChIKey | SMEBAPAZIWZOAR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|