C10H17N5O2 — CID 80797128
methyl 3-[[2-amino-6-(ethylamino)pyrimidin-4-yl]amino]propanoate (PubChem CID 80797128) has the molecular formula C10H17N5O2 and a molecular weight of 239.28 g/mol. Its IUPAC name is methyl 3-[[2-amino-6-(ethylamino)pyrimidin-4-yl]amino]propanoate.
| Compound Name | methyl 3-[[2-amino-6-(ethylamino)pyrimidin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 80797128 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | methyl 3-[[2-amino-6-(ethylamino)pyrimidin-4-yl]amino]propanoate |
| SMILES | CCNc1cc(NCCC(=O)OC)nc(N)n1 |
| InChI | InChI=1S/C10H17N5O2/c1-3-12-7-6-8(15-10(11)14-7)13-5-4-9(16)17-2/h6H,3-5H2,1-2H3,(H4,11,12,13,14,15) |
| InChIKey | GPJGJYJWPBHVEP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |