C12H17F3N4O2 — CID 106771014
methyl 3-[[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]propanoate (PubChem CID 106771014) has the molecular formula C12H17F3N4O2 and a molecular weight of 306.29 g/mol. Its IUPAC name is methyl 3-[[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]propanoate.
| Compound Name | methyl 3-[[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 106771014 |
| Molecular Formula | C12H17F3N4O2 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | methyl 3-[[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]propanoate |
| SMILES | CCCNc1cc(NCCC(=O)OC)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H17F3N4O2/c1-3-5-16-8-7-9(17-6-4-10(20)21-2)19-11(18-8)12(13,14)15/h7H,3-6H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | KCZUYJKSXBNIOD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |