C10H14F3N5O — CID 106771575
N-methyl-3-[[6-(methylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]propanamide (PubChem CID 106771575) has the molecular formula C10H14F3N5O and a molecular weight of 277.25 g/mol. Its IUPAC name is N-methyl-3-[[6-(methylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]propanamide.
| Compound Name | N-methyl-3-[[6-(methylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]propanamide |
|---|---|
| PubChem CID | 106771575 |
| Molecular Formula | C10H14F3N5O |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-methyl-3-[[6-(methylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]propanamide |
| SMILES | CNC(=O)CCNc1cc(NC)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H14F3N5O/c1-14-6-5-7(16-4-3-8(19)15-2)18-9(17-6)10(11,12)13/h5H,3-4H2,1-2H3,(H,15,19)(H2,14,16,17,18) |
| InChIKey | CRKSZEAPTNCUNO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |