C12H21N5O2 — CID 80964160
methyl 3-[(2-tert-butyl-6-hydrazinylpyrimidin-4-yl)amino]propanoate (PubChem CID 80964160) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is methyl 3-[(2-tert-butyl-6-hydrazinylpyrimidin-4-yl)amino]propanoate.
| Compound Name | methyl 3-[(2-tert-butyl-6-hydrazinylpyrimidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 80964160 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | methyl 3-[(2-tert-butyl-6-hydrazinylpyrimidin-4-yl)amino]propanoate |
| SMILES | COC(=O)CCNc1cc(NN)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C12H21N5O2/c1-12(2,3)11-15-8(7-9(16-11)17-13)14-6-5-10(18)19-4/h7H,5-6,13H2,1-4H3,(H2,14,15,16,17) |
| InChIKey | NIVOOGLKBIWMOG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|