C11H15F3N4O2 — CID 106770479
methyl 2-[[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]acetate (PubChem CID 106770479) has the molecular formula C11H15F3N4O2 and a molecular weight of 292.26 g/mol. Its IUPAC name is methyl 2-[[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]acetate.
| Compound Name | methyl 2-[[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 106770479 |
| Molecular Formula | C11H15F3N4O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | methyl 2-[[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]acetate |
| SMILES | CCCNc1cc(NCC(=O)OC)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H15F3N4O2/c1-3-4-15-7-5-8(16-6-9(19)20-2)18-10(17-7)11(12,13)14/h5H,3-4,6H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | HNLOAFLEAAKMAI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |