C9H14N4O2S — CID 80885529
methyl 2-[2-amino-6-(ethylamino)pyrimidin-4-yl]sulfanylacetate (PubChem CID 80885529) has the molecular formula C9H14N4O2S and a molecular weight of 242.30 g/mol. Its IUPAC name is methyl 2-[2-amino-6-(ethylamino)pyrimidin-4-yl]sulfanylacetate.
| Compound Name | methyl 2-[2-amino-6-(ethylamino)pyrimidin-4-yl]sulfanylacetate |
|---|---|
| PubChem CID | 80885529 |
| Molecular Formula | C9H14N4O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | methyl 2-[2-amino-6-(ethylamino)pyrimidin-4-yl]sulfanylacetate |
| SMILES | CCNc1cc(SCC(=O)OC)nc(N)n1 |
| InChI | InChI=1S/C9H14N4O2S/c1-3-11-6-4-7(13-9(10)12-6)16-5-8(14)15-2/h4H,3,5H2,1-2H3,(H3,10,11,12,13) |
| InChIKey | HPBBHICMMWPZNP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |