C8H11N3O2S — CID 80886623
methyl 2-(6-amino-2-methylpyrimidin-4-yl)sulfanylacetate (PubChem CID 80886623) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is methyl 2-(6-amino-2-methylpyrimidin-4-yl)sulfanylacetate.
| Compound Name | methyl 2-(6-amino-2-methylpyrimidin-4-yl)sulfanylacetate |
|---|---|
| PubChem CID | 80886623 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | methyl 2-(6-amino-2-methylpyrimidin-4-yl)sulfanylacetate |
| SMILES | COC(=O)CSc1cc(N)nc(C)n1 |
| InChI | InChI=1S/C8H11N3O2S/c1-5-10-6(9)3-7(11-5)14-4-8(12)13-2/h3H,4H2,1-2H3,(H2,9,10,11) |
| InChIKey | XRNIDQMTOQCCPG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |