C9H14N4O2S — CID 80923704
ethyl 2-(6-hydrazinyl-2-methylpyrimidin-4-yl)sulfanylacetate (PubChem CID 80923704) has the molecular formula C9H14N4O2S and a molecular weight of 242.30 g/mol. Its IUPAC name is ethyl 2-(6-hydrazinyl-2-methylpyrimidin-4-yl)sulfanylacetate.
| Compound Name | ethyl 2-(6-hydrazinyl-2-methylpyrimidin-4-yl)sulfanylacetate |
|---|---|
| PubChem CID | 80923704 |
| Molecular Formula | C9H14N4O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | ethyl 2-(6-hydrazinyl-2-methylpyrimidin-4-yl)sulfanylacetate |
| SMILES | CCOC(=O)CSc1cc(NN)nc(C)n1 |
| InChI | InChI=1S/C9H14N4O2S/c1-3-15-9(14)5-16-8-4-7(13-10)11-6(2)12-8/h4H,3,5,10H2,1-2H3,(H,11,12,13) |
| InChIKey | XOVYTOWSJCLTFW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|