C8H12N4O2S — CID 80922675
ethyl 2-(2-hydrazinylpyrimidin-4-yl)sulfanylacetate (PubChem CID 80922675) has the molecular formula C8H12N4O2S and a molecular weight of 228.28 g/mol. Its IUPAC name is ethyl 2-(2-hydrazinylpyrimidin-4-yl)sulfanylacetate.
| Compound Name | ethyl 2-(2-hydrazinylpyrimidin-4-yl)sulfanylacetate |
|---|---|
| PubChem CID | 80922675 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | ethyl 2-(2-hydrazinylpyrimidin-4-yl)sulfanylacetate |
| SMILES | CCOC(=O)CSc1ccnc(NN)n1 |
| InChI | InChI=1S/C8H12N4O2S/c1-2-14-7(13)5-15-6-3-4-10-8(11-6)12-9/h3-4H,2,5,9H2,1H3,(H,10,11,12) |
| InChIKey | GWHKVEJRRZDFRJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|