C11H22N6 — CID 80915909
4-N-(3-ethylpentan-3-yl)-6-hydrazinylpyrimidine-2,4-diamine (PubChem CID 80915909) has the molecular formula C11H22N6 and a molecular weight of 238.34 g/mol. Its IUPAC name is 4-N-(3-ethylpentan-3-yl)-6-hydrazinylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-ethylpentan-3-yl)-6-hydrazinylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80915909 |
| Molecular Formula | C11H22N6 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 4-N-(3-ethylpentan-3-yl)-6-hydrazinylpyrimidine-2,4-diamine |
| SMILES | CCC(CC)(CC)Nc1cc(NN)nc(N)n1 |
| InChI | InChI=1S/C11H22N6/c1-4-11(5-2,6-3)16-8-7-9(17-13)15-10(12)14-8/h7H,4-6,13H2,1-3H3,(H4,12,14,15,16,17) |
| InChIKey | ZTFQRIIMNAMUPB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|