C10H20N6 — CID 80907899
4-N-hexan-2-yl-6-hydrazinylpyrimidine-2,4-diamine (PubChem CID 80907899) has the molecular formula C10H20N6 and a molecular weight of 224.31 g/mol. Its IUPAC name is 4-N-hexan-2-yl-6-hydrazinylpyrimidine-2,4-diamine.
| Compound Name | 4-N-hexan-2-yl-6-hydrazinylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80907899 |
| Molecular Formula | C10H20N6 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 4-N-hexan-2-yl-6-hydrazinylpyrimidine-2,4-diamine |
| SMILES | CCCCC(C)Nc1cc(NN)nc(N)n1 |
| InChI | InChI=1S/C10H20N6/c1-3-4-5-7(2)13-8-6-9(16-12)15-10(11)14-8/h6-7H,3-5,12H2,1-2H3,(H4,11,13,14,15,16) |
| InChIKey | BAAGILNYNCQZFU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|