C7H11F3N6 — CID 114567551
2-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]-1,1-dimethylhydrazine (PubChem CID 114567551) has the molecular formula C7H11F3N6 and a molecular weight of 236.20 g/mol. Its IUPAC name is 2-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]-1,1-dimethylhydrazine.
| Compound Name | 2-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 114567551 |
| Molecular Formula | C7H11F3N6 |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]-1,1-dimethylhydrazine |
| SMILES | CN(C)Nc1cc(C(F)(F)F)nc(NN)n1 |
| InChI | InChI=1S/C7H11F3N6/c1-16(2)15-5-3-4(7(8,9)10)12-6(13-5)14-11/h3H,11H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | ZYOXTINVJBVKQU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|