C9H12F3N5 — CID 114567178
2-hydrazinyl-N-(2-methylcyclopropyl)-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 114567178) has the molecular formula C9H12F3N5 and a molecular weight of 247.22 g/mol. Its IUPAC name is 2-hydrazinyl-N-(2-methylcyclopropyl)-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-(2-methylcyclopropyl)-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114567178 |
| Molecular Formula | C9H12F3N5 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-hydrazinyl-N-(2-methylcyclopropyl)-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CC1CC1Nc1cc(C(F)(F)F)nc(NN)n1 |
| InChI | InChI=1S/C9H12F3N5/c1-4-2-5(4)14-7-3-6(9(10,11)12)15-8(16-7)17-13/h3-5H,2,13H2,1H3,(H2,14,15,16,17) |
| InChIKey | OWNWHEILRUEBJG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|