C10H17F3N6 — CID 114567188
N'-ethyl-N-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]-N'-methylethane-1,2-diamine (PubChem CID 114567188) has the molecular formula C10H17F3N6 and a molecular weight of 278.28 g/mol. Its IUPAC name is N'-ethyl-N-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]-N'-methylethane-1,2-diamine.
| Compound Name | N'-ethyl-N-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 114567188 |
| Molecular Formula | C10H17F3N6 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N'-ethyl-N-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]-N'-methylethane-1,2-diamine |
| SMILES | CCN(C)CCNc1cc(C(F)(F)F)nc(NN)n1 |
| InChI | InChI=1S/C10H17F3N6/c1-3-19(2)5-4-15-8-6-7(10(11,12)13)16-9(17-8)18-14/h6H,3-5,14H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | CNJMEVIXUWQFIM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|