C8H10F4N4 — CID 106296079
6-N-methyl-2-N-(2,2,3,3-tetrafluoropropyl)pyrazine-2,6-diamine (PubChem CID 106296079) has the molecular formula C8H10F4N4 and a molecular weight of 238.19 g/mol. Its IUPAC name is 6-N-methyl-2-N-(2,2,3,3-tetrafluoropropyl)pyrazine-2,6-diamine.
| Compound Name | 6-N-methyl-2-N-(2,2,3,3-tetrafluoropropyl)pyrazine-2,6-diamine |
|---|---|
| PubChem CID | 106296079 |
| Molecular Formula | C8H10F4N4 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 6-N-methyl-2-N-(2,2,3,3-tetrafluoropropyl)pyrazine-2,6-diamine |
| SMILES | CNc1cncc(NCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C8H10F4N4/c1-13-5-2-14-3-6(16-5)15-4-8(11,12)7(9)10/h2-3,7H,4H2,1H3,(H2,13,15,16) |
| InChIKey | CPVLLDGFIOTVRL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|