C10H13F4N3 — CID 106296062
3-N-ethyl-5-N-(2,2,3,3-tetrafluoropropyl)pyridine-3,5-diamine (PubChem CID 106296062) has the molecular formula C10H13F4N3 and a molecular weight of 251.23 g/mol. Its IUPAC name is 3-N-ethyl-5-N-(2,2,3,3-tetrafluoropropyl)pyridine-3,5-diamine.
| Compound Name | 3-N-ethyl-5-N-(2,2,3,3-tetrafluoropropyl)pyridine-3,5-diamine |
|---|---|
| PubChem CID | 106296062 |
| Molecular Formula | C10H13F4N3 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 3-N-ethyl-5-N-(2,2,3,3-tetrafluoropropyl)pyridine-3,5-diamine |
| SMILES | CCNc1cncc(NCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C10H13F4N3/c1-2-16-7-3-8(5-15-4-7)17-6-10(13,14)9(11)12/h3-5,9,16-17H,2,6H2,1H3 |
| InChIKey | FOUSKEDDOXJMEN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|