C16H29N3 — CID 104535385
5-N-(2,2-dimethylheptyl)-3-N-ethylpyridine-3,5-diamine (PubChem CID 104535385) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is 5-N-(2,2-dimethylheptyl)-3-N-ethylpyridine-3,5-diamine.
| Compound Name | 5-N-(2,2-dimethylheptyl)-3-N-ethylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 104535385 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | 5-N-(2,2-dimethylheptyl)-3-N-ethylpyridine-3,5-diamine |
| SMILES | CCCCCC(C)(C)CNc1cncc(NCC)c1 |
| InChI | InChI=1S/C16H29N3/c1-5-7-8-9-16(3,4)13-19-15-10-14(18-6-2)11-17-12-15/h10-12,18-19H,5-9,13H2,1-4H3 |
| InChIKey | QDAGNCNMRZNEKA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|