C15H26N4O2 — CID 80929398
N-(2,2-dimethylheptyl)-3-hydrazinyl-5-nitroaniline (PubChem CID 80929398) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is N-(2,2-dimethylheptyl)-3-hydrazinyl-5-nitroaniline.
| Compound Name | N-(2,2-dimethylheptyl)-3-hydrazinyl-5-nitroaniline |
|---|---|
| PubChem CID | 80929398 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | N-(2,2-dimethylheptyl)-3-hydrazinyl-5-nitroaniline |
| SMILES | CCCCCC(C)(C)CNc1cc(NN)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H26N4O2/c1-4-5-6-7-15(2,3)11-17-12-8-13(18-16)10-14(9-12)19(20)21/h8-10,17-18H,4-7,11,16H2,1-3H3 |
| InChIKey | JQOKJXYJFYGANN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|