C11H13N5O3 — CID 114181142
3-hydrazinyl-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-nitroaniline (PubChem CID 114181142) has the molecular formula C11H13N5O3 and a molecular weight of 263.26 g/mol. Its IUPAC name is 3-hydrazinyl-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-nitroaniline.
| Compound Name | 3-hydrazinyl-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-nitroaniline |
|---|---|
| PubChem CID | 114181142 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 3-hydrazinyl-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-nitroaniline |
| SMILES | Cc1cnc(CNc2cc(NN)cc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C11H13N5O3/c1-7-5-14-11(19-7)6-13-8-2-9(15-12)4-10(3-8)16(17)18/h2-5,13,15H,6,12H2,1H3 |
| InChIKey | JKMLEMUJKMNAIF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|