C8H8N4O3S — CID 106373712
N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-nitro-1,3-thiazol-2-amine (PubChem CID 106373712) has the molecular formula C8H8N4O3S and a molecular weight of 240.24 g/mol. Its IUPAC name is N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-nitro-1,3-thiazol-2-amine.
| Compound Name | N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-nitro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 106373712 |
| Molecular Formula | C8H8N4O3S |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-nitro-1,3-thiazol-2-amine |
| SMILES | Cc1cnc(CNc2ncc([N+](=O)[O-])s2)o1 |
| InChI | InChI=1S/C8H8N4O3S/c1-5-2-9-6(15-5)3-10-8-11-4-7(16-8)12(13)14/h2,4H,3H2,1H3,(H,10,11) |
| InChIKey | CBOIDXHQYRFNRI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|