C14H12N4O3 — CID 106373840
N-[(5-methyl-1,3-oxazol-2-yl)methyl]-8-nitroquinolin-4-amine (PubChem CID 106373840) has the molecular formula C14H12N4O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is N-[(5-methyl-1,3-oxazol-2-yl)methyl]-8-nitroquinolin-4-amine.
| Compound Name | N-[(5-methyl-1,3-oxazol-2-yl)methyl]-8-nitroquinolin-4-amine |
|---|---|
| PubChem CID | 106373840 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | N-[(5-methyl-1,3-oxazol-2-yl)methyl]-8-nitroquinolin-4-amine |
| SMILES | Cc1cnc(CNc2ccnc3c([N+](=O)[O-])cccc23)o1 |
| InChI | InChI=1S/C14H12N4O3/c1-9-7-17-13(21-9)8-16-11-5-6-15-14-10(11)3-2-4-12(14)18(19)20/h2-7H,8H2,1H3,(H,15,16) |
| InChIKey | TUOMFZYAOCBDEQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|