C11H9N7O2 — CID 83066870
8-nitro-N-(2H-tetrazol-5-ylmethyl)quinolin-4-amine (PubChem CID 83066870) has the molecular formula C11H9N7O2 and a molecular weight of 271.24 g/mol. Its IUPAC name is 8-nitro-N-(2H-tetrazol-5-ylmethyl)quinolin-4-amine.
| Compound Name | 8-nitro-N-(2H-tetrazol-5-ylmethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 83066870 |
| Molecular Formula | C11H9N7O2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 8-nitro-N-(2H-tetrazol-5-ylmethyl)quinolin-4-amine |
| SMILES | O=[N+]([O-])c1cccc2c(NCc3nn[nH]n3)ccnc12 |
| InChI | InChI=1S/C11H9N7O2/c19-18(20)9-3-1-2-7-8(4-5-12-11(7)9)13-6-10-14-16-17-15-10/h1-5H,6H2,(H,12,13)(H,14,15,16,17) |
| InChIKey | DXKWCCJOYJWOKX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|