C13H24N4O — CID 103895908
5-[[6-(ethylamino)pyrazin-2-yl]amino]-4,4-dimethylpentan-1-ol (PubChem CID 103895908) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 5-[[6-(ethylamino)pyrazin-2-yl]amino]-4,4-dimethylpentan-1-ol.
| Compound Name | 5-[[6-(ethylamino)pyrazin-2-yl]amino]-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 103895908 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 5-[[6-(ethylamino)pyrazin-2-yl]amino]-4,4-dimethylpentan-1-ol |
| SMILES | CCNc1cncc(NCC(C)(C)CCCO)n1 |
| InChI | InChI=1S/C13H24N4O/c1-4-15-11-8-14-9-12(17-11)16-10-13(2,3)6-5-7-18/h8-9,18H,4-7,10H2,1-3H3,(H2,15,16,17) |
| InChIKey | VHXOKGKTSQQKFO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |