C13H24N4O — CID 114149316
N-(6-ethoxypyrazin-2-yl)-2,2-dimethylpentane-1,5-diamine (PubChem CID 114149316) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is N-(6-ethoxypyrazin-2-yl)-2,2-dimethylpentane-1,5-diamine.
| Compound Name | N-(6-ethoxypyrazin-2-yl)-2,2-dimethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 114149316 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | N-(6-ethoxypyrazin-2-yl)-2,2-dimethylpentane-1,5-diamine |
| SMILES | CCOc1cncc(NCC(C)(C)CCCN)n1 |
| InChI | InChI=1S/C13H24N4O/c1-4-18-12-9-15-8-11(17-12)16-10-13(2,3)6-5-7-14/h8-9H,4-7,10,14H2,1-3H3,(H,16,17) |
| InChIKey | YZGAMCXQPLJFOR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |