C10H18N4O2 — CID 106182379
2-N-(6-ethoxypyrazin-2-yl)-3-methoxypropane-1,2-diamine (PubChem CID 106182379) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-N-(6-ethoxypyrazin-2-yl)-3-methoxypropane-1,2-diamine.
| Compound Name | 2-N-(6-ethoxypyrazin-2-yl)-3-methoxypropane-1,2-diamine |
|---|---|
| PubChem CID | 106182379 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 2-N-(6-ethoxypyrazin-2-yl)-3-methoxypropane-1,2-diamine |
| SMILES | CCOc1cncc(NC(CN)COC)n1 |
| InChI | InChI=1S/C10H18N4O2/c1-3-16-10-6-12-5-9(14-10)13-8(4-11)7-15-2/h5-6,8H,3-4,7,11H2,1-2H3,(H,13,14) |
| InChIKey | RBLQEDOPBBVZAX-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |