C12H22N4O2 — CID 114151042
4-methoxy-3-N-(6-propoxypyrazin-2-yl)butane-1,3-diamine (PubChem CID 114151042) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-methoxy-3-N-(6-propoxypyrazin-2-yl)butane-1,3-diamine.
| Compound Name | 4-methoxy-3-N-(6-propoxypyrazin-2-yl)butane-1,3-diamine |
|---|---|
| PubChem CID | 114151042 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 4-methoxy-3-N-(6-propoxypyrazin-2-yl)butane-1,3-diamine |
| SMILES | CCCOc1cncc(NC(CCN)COC)n1 |
| InChI | InChI=1S/C12H22N4O2/c1-3-6-18-12-8-14-7-11(16-12)15-10(4-5-13)9-17-2/h7-8,10H,3-6,9,13H2,1-2H3,(H,15,16) |
| InChIKey | MTXZAVMTXNJEGH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |