C12H19N3O3 — CID 66458303
methyl 6-(1-methoxypentan-2-ylamino)pyrazine-2-carboxylate (PubChem CID 66458303) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is methyl 6-(1-methoxypentan-2-ylamino)pyrazine-2-carboxylate.
| Compound Name | methyl 6-(1-methoxypentan-2-ylamino)pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66458303 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | methyl 6-(1-methoxypentan-2-ylamino)pyrazine-2-carboxylate |
| SMILES | CCCC(COC)Nc1cncc(C(=O)OC)n1 |
| InChI | InChI=1S/C12H19N3O3/c1-4-5-9(8-17-2)14-11-7-13-6-10(15-11)12(16)18-3/h6-7,9H,4-5,8H2,1-3H3,(H,14,15) |
| InChIKey | RZQVKOULWJPKHN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |