C7H10N4OS — CID 90714777
(6-ethoxypyrazin-2-yl)thiourea (PubChem CID 90714777) has the molecular formula C7H10N4OS and a molecular weight of 198.25 g/mol. Its IUPAC name is (6-ethoxypyrazin-2-yl)thiourea.
| Compound Name | (6-ethoxypyrazin-2-yl)thiourea |
|---|---|
| PubChem CID | 90714777 |
| Molecular Formula | C7H10N4OS |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | (6-ethoxypyrazin-2-yl)thiourea |
| SMILES | CCOc1cncc(NC(N)=S)n1 |
| InChI | InChI=1S/C7H10N4OS/c1-2-12-6-4-9-3-5(10-6)11-7(8)13/h3-4H,2H2,1H3,(H3,8,10,11,13) |
| InChIKey | QIBVHGULQMEDEG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|