C13H20N4O3 — CID 133430656
4-[[(6-ethoxypyrazin-2-yl)amino]methyl]oxane-4-carboxamide (PubChem CID 133430656) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-[[(6-ethoxypyrazin-2-yl)amino]methyl]oxane-4-carboxamide.
| Compound Name | 4-[[(6-ethoxypyrazin-2-yl)amino]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 133430656 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 4-[[(6-ethoxypyrazin-2-yl)amino]methyl]oxane-4-carboxamide |
| SMILES | CCOc1cncc(NCC2(C(N)=O)CCOCC2)n1 |
| InChI | InChI=1S/C13H20N4O3/c1-2-20-11-8-15-7-10(17-11)16-9-13(12(14)18)3-5-19-6-4-13/h7-8H,2-6,9H2,1H3,(H2,14,18)(H,16,17) |
| InChIKey | UKTFHIRPDJJQAP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |