C13H19N3O4 — CID 115438674
4-[[(6-ethoxypyrazin-2-yl)amino]methyl]oxane-4-carboxylic acid (PubChem CID 115438674) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-[[(6-ethoxypyrazin-2-yl)amino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[(6-ethoxypyrazin-2-yl)amino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 115438674 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-[[(6-ethoxypyrazin-2-yl)amino]methyl]oxane-4-carboxylic acid |
| SMILES | CCOc1cncc(NCC2(C(=O)O)CCOCC2)n1 |
| InChI | InChI=1S/C13H19N3O4/c1-2-20-11-8-14-7-10(16-11)15-9-13(12(17)18)3-5-19-6-4-13/h7-8H,2-6,9H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | PGULQQDJXHYTHP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |