C11H20N4O — CID 107323521
N'-(6-ethoxypyrazin-2-yl)pentane-1,5-diamine (PubChem CID 107323521) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is N'-(6-ethoxypyrazin-2-yl)pentane-1,5-diamine.
| Compound Name | N'-(6-ethoxypyrazin-2-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 107323521 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | N'-(6-ethoxypyrazin-2-yl)pentane-1,5-diamine |
| SMILES | CCOc1cncc(NCCCCCN)n1 |
| InChI | InChI=1S/C11H20N4O/c1-2-16-11-9-13-8-10(15-11)14-7-5-3-4-6-12/h8-9H,2-7,12H2,1H3,(H,14,15) |
| InChIKey | VALSWNIDAFTQPH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|